| Ονομασία του προϊόντος |
3-Amino-6-chloro-4-picoline |
| Συνώνυμα |
2-CHLORO-4-METHYL-5-AMINOPYRIDINE; 6-chloro-4-methylpyridin-3-amine; 5-Amino-2-chloro-4-methylpyridine; 5-amino-2-chloro-4-picoline |
| MF |
C6H7ClN2 |
| Μοριακό βάρος |
142.5862 |
| InChI |
InChI=1/C6H7ClN2/c1-4-2-6(7)9-3-5(4)8/h2-3H,8H2,1H3 |
| CAS ΟΧΙ |
66909-38-4 |
| Μοριακή δομή |
|
| Πυκνότητα |
1.26g/cm3 |
| Σημείο βρασμού |
309.7°C at 760 mmHg |
| Δείκτης διάθλασης |
1.592 |
| Σημείο ανάφλεξης |
141.1°C |
| Σύμβολα επικινδυνότητας |
 Xi:Irritant;
|
| Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
