Ονομασία του προϊόντος |
2,4,6-Trichloroiodobenzene |
Συνώνυμα |
2,4,5-Trichloroiodobenzene; 1-Iodo-2,4,5-trichlorobenzene; 1,2,4-trichloro-5-iodobenzene |
MF |
C6H2Cl3I |
Μοριακό βάρος |
307.3435 |
InChI |
InChI=1/C6H2Cl3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H |
CAS ΟΧΙ |
7145-82-6 |
Μοριακή δομή |
|
Πυκνότητα |
2.085g/cm3 |
Σημείο τήξης |
56-58℃ |
Σημείο βρασμού |
292.8°C at 760 mmHg |
Δείκτης διάθλασης |
1.651 |
Σημείο ανάφλεξης |
130.9°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|