termék neve |
3-Hepten-2-one |
Szinonimák |
AI3-22032; Butylideneacetone; FEMA No. 3400; Methyl pentenyl ketone; (3E)-hept-3-en-2-one |
MF |
C7H12O |
Molekulatömeg |
112.1696 |
InChI |
InChI=1/C7H12O/c1-3-4-5-6-7(2)8/h5-6H,3-4H2,1-2H3/b6-5+ |
CAS-szám |
1119-44-4 |
EINECS |
214-278-8 |
Molekuláris szerkezete |
|
Sűrűség |
0.832g/cm3 |
Forráspont |
157.8°C at 760 mmHg |
Törésmutató |
1.426 |
Gyulladáspont |
52.2°C |
Kockázatot kódok |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|