termék neve |
6-Amino-5-bromo-2-picoline |
Szinonimák |
2-amino-3-bromo-6-methylpyridine; 3-bromo-6-methylpyridin-2-amine; 2-amino-3-bromo-6-methylpyridinium |
MF |
C6H8BrN2 |
Molekulatömeg |
188.0446 |
InChI |
InChI=1/C6H7BrN2/c1-4-2-3-5(7)6(8)9-4/h2-3H,1H3,(H2,8,9)/p+1 |
CAS-szám |
126325-46-0 |
Molekuláris szerkezete |
|
Forráspont |
238.5°C at 760 mmHg |
Gyulladáspont |
98.1°C |
Veszély szimbólumok |
Xi:Irritant;
|
Kockázatot kódok |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|