| termék neve |
2-Iodo-3-methylpyridine |
| Szinonimák |
2-Iodo-3-picoline |
| MF |
C6H6IN |
| Molekulatömeg |
219.023 |
| InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| CAS-szám |
22282-58-2 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.81g/cm3 |
| Forráspont |
237.412°C at 760 mmHg |
| Törésmutató |
1.612 |
| Gyulladáspont |
97.384°C |
| Kockázatot kódok |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
