termék neve |
3-Fluoro-4-methylbenzylamine |
Szinonimák |
1-(3-fluoro-4-methylphenyl)methanamine |
MF |
C8H10FN |
Molekulatömeg |
139.1701 |
InChI |
InChI=1/C8H10FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,5,10H2,1H3 |
CAS-szám |
261951-67-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.071g/cm3 |
Forráspont |
198°C at 760 mmHg |
Törésmutató |
1.52 |
Gyulladáspont |
82.4°C |
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|