termék neve |
4-Piperazinoacetophenone |
Szinonimák |
piperazin-4-ylacetophenone; 1-[4-(piperazin-1-yl)phenyl]ethanone; 1-phenyl-2-piperazin-1-ylethanone; 4-(4-acetylphenyl)piperazin-1-ium; 4'-poperazinoacetophenone; 4'-Piperazinoacetophenone |
MF |
C12H17N2O |
Molekulatömeg |
205.2756 |
InChI |
InChI=1/C12H16N2O/c1-10(15)11-2-4-12(5-3-11)14-8-6-13-7-9-14/h2-5,13H,6-9H2,1H3/p+1 |
CAS-szám |
51639-48-6 |
EINECS |
257-332-6 |
Molekuláris szerkezete |
|
Olvadáspont |
107-112℃ |
Forráspont |
382.4°C at 760 mmHg |
Gyulladáspont |
185.1°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|