| termék neve |
2-Fluorophenethylamine |
| Szinonimák |
2-(2-Fluorophenyl)-ethylamine; 2-(2-fluorophenyl)ethanamine; 2-(2-fluorophenyl)ethanaminium; 2-Fluoro-benzeneethanamine |
| MF |
C8H11FN |
| Molekulatömeg |
140.1775 |
| InChI |
InChI=1/C8H10FN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5-6,10H2/p+1 |
| CAS-szám |
52721-69-4 |
| Molekuláris szerkezete |
|
| Forráspont |
242.8°C at 760 mmHg |
| Gyulladáspont |
77.2°C |
| Veszély szimbólumok |
 C:Corrosive;
|
| Kockázatot kódok |
R34:Causes burns.;
|
| Biztonsági LeÃrás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
