termék neve |
2-Acetamidofluorene |
Szinonimák |
N-(2-Fluorenyl)acetamide; Acetamidofluorene; N-(9H-fluoren-2-yl)acetamide; 2-(9H-fluoren-2-yl)acetamide |
MF |
C15H13NO |
Molekulatömeg |
223.2698 |
InChI |
InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
CAS-szám |
53-96-3 |
EINECS |
200-188-6 |
Molekuláris szerkezete |
|
Sűrűség |
1.227g/cm3 |
Olvadáspont |
192-196℃ |
Forráspont |
471.2°C at 760 mmHg |
Törésmutató |
1.656 |
Gyulladáspont |
238.8°C |
Vízben való oldhatóság |
0.000529 g/100 mL |
Veszély szimbólumok |
T:Toxic;
|
Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R46:May cause heritable genetic damages.;
|
Biztonsági Leírás |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|