termék neve |
3-Heptanol |
Szinonimák |
heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
MF |
C7H16O |
Molekulatömeg |
116.2013 |
InChI |
InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
CAS-szám |
589-82-2 |
EINECS |
209-661-1 |
Molekuláris szerkezete |
|
Sűrűség |
0.818g/cm3 |
Olvadáspont |
-70℃ |
Forráspont |
156.7°C at 760 mmHg |
Törésmutató |
1.42 |
Gyulladáspont |
54.4°C |
Veszély szimbólumok |
Xn:Harmful;
|
Kockázatot kódok |
R22:Harmful if swallowed.;
R36:Irritating to eyes.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|