| termék neve |
N-Acetylthiourea |
| Szinonimák |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
| MF |
C3H6N2OS |
| Molekulatömeg |
118.1575 |
| InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
| CAS-szám |
591-08-2 |
| EINECS |
209-699-9 |
| Molekuláris szerkezete |
|
| Sűrűség |
1.275g/cm3 |
| Olvadáspont |
166-168℃ |
| Forráspont |
208.6°C at 760 mmHg |
| Törésmutató |
1.569 |
| Gyulladáspont |
80°C |
| Veszély szimbólumok |
 T:Toxic;
|
| Kockázatot kódok |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Biztonsági Leírás |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
