| Nama produk |
6-Methylpyridazin-3-amine |
| Sinonim |
3-Amino-6-Methylpyridazine |
| MF |
C5H7N3 |
| Berat Molekul |
109.13068 |
| InChI |
InChI=1/C4H4IN3/c5-3-1-2-4(6)8-7-3/h1-2H,(H2,6,8) |
| CAS NO |
18591-82-7 |
| EINECS |
242-430-3 |
| Struktur Molekul |
|
| Kepadatan |
2.204g/cm3 |
| Titik lebur |
230℃ |
| Titik didih |
399.6°C at 760 mmHg |
| Indeks bias |
1.719 |
| Titik nyala |
195.5°C |
| Simbol bahaya |
 Xi:Irritant;
|
| Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
