Nama produk |
3-Bromo-2,4,5,6-tetrafluorobenzoylchloride |
Sinonim |
3-Bromo-2,4,5,6-tetrafluorobenzoyl chloride |
MF |
C7BrClF4O |
Berat Molekul |
291.4249 |
InChI |
InChI=1/C7BrClF4O/c8-2-3(10)1(7(9)14)4(11)6(13)5(2)12 |
CAS NO |
292621-46-6 |
Struktur Molekul |
|
Kepadatan |
1.957g/cm3 |
Titik didih |
206.8°C at 760 mmHg |
Indeks bias |
1.505 |
Titik nyala |
78.9°C |
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|