Nama produk |
3,5-Dibromo-4-methylpyridine |
Sinonim |
3,5-Dibromo-4-picoline |
MF |
C6H5Br2N |
Berat Molekul |
250.9186 |
InChI |
InChI=1/C6H5Br2N/c1-4-5(7)2-9-3-6(4)8/h2-3H,1H3 |
CAS NO |
3430-23-7 |
Struktur Molekul |
|
Kepadatan |
1.911g/cm3 |
Titik didih |
243°C at 760 mmHg |
Indeks bias |
1.593 |
Titik nyala |
100.7°C |
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|