| Nama produk |
4-Isothiocyanatophenetol |
| Sinonim |
4-Ethoxyphenyl isothiocyanate; 1-ethoxy-4-isothiocyanatobenzene |
| MF |
C9H9NOS |
| Berat Molekul |
179.2389 |
| InChI |
InChI=1/C9H9NOS/c1-2-11-9-5-3-8(4-6-9)10-7-12/h3-6H,2H2,1H3 |
| CAS NO |
3460-49-9 |
| EINECS |
222-410-0 |
| Struktur Molekul |
|
| Kepadatan |
1.06g/cm3 |
| Titik didih |
288.7°C at 760 mmHg |
| Indeks bias |
1.544 |
| Titik nyala |
128.4°C |
| Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
