Nama produk |
Bromochloroacetonitrile |
Sinonim |
Bromochloromethyl cyanide; CCRIS 2672; HSDB 7617; Acetonitrile, bromochloro- |
MF |
C2HBrClN |
Berat Molekul |
154.393 |
InChI |
InChI=1/C2HBrClN/c3-2(4)1-5/h2H |
CAS NO |
83463-62-1 |
Struktur Molekul |
|
Kepadatan |
1.932g/cm3 |
Titik didih |
121.1°C at 760 mmHg |
Indeks bias |
1.506 |
Titik nyala |
27.1°C |
Kode Risiko |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|