שם המוצר |
2,4,5-Trichlorothiophenol |
נרדפות |
2,4,5-Trichlorobenzenethiol; Trichlorothiophenol; 2,4,5-trichlorobenzenethiolate |
מולקולרית פורמולה |
C6H2Cl3S |
משקל מולקולרי |
212.5046 |
InChI |
InChI=1/C6H3Cl3S/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H/p-1 |
מספר CAS |
3773-14-6 |
EINECS |
223-223-7 |
מבנה מולקולרי |
|
נקודת ההתוך |
117-118℃ |
נקודת רתיחה |
283.2°C at 760 mmHg |
נקודת הבזק |
114.6°C |
Hazard סימנים |
Xi:Irritant;
|
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|