שם המוצר |
3-Indolylacetonitrile |
נרדפות |
Indole-3-acetonitrile,(Indolyl-3-acetonitrile); Indolyl-3-acetonitrile; Indole-3-acetonitrile; 1H-Indole-3-acetonitrile; BETA-INDOLYLACETONITRILE; 2-(1H-INDOL-3-YL)ACETONITRILE; (1H-INDOL-3-YL)-ACETONITRILE; 3-INDOLEACETONITRILE; 3-Indole acetonitrile |
מולקולרית פורמולה |
C10H8N2 |
משקל מולקולרי |
156.18 |
InChI |
InChI=1/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
מספר CAS |
771-51-7 |
EINECS |
212-232-1 |
מבנה מולקולרי |
|
צפיפות |
158 |
נקודת ההתוך |
33-35℃ |
נקודת רתיחה |
156-160℃(0.2 torr) |
משקל סגולי |
1.6085-1.6105 |
נקודת הבזק |
206℃ |
Hazard סימנים |
Xn:Harmful;
|
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
בטיחות תיאור |
S36/37:Wear suitable protective clothing and gloves.;
|
|