| उत्पाद का नाम |
3-Chlorodiphenylamine |
| समानार्थी |
Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| आणविक फार्मूला |
C12H10ClN |
| आण्विक वजन |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| कैस रजिस्टी संख्या |
101-17-7 |
| EINECS |
202-922-0 |
| आणविक संरचना |
|
| घनत्व |
1.216g/cm3 |
| उबलने का समय |
337.8°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.642 |
| फ्लैश प्वाइंट |
147.4°C |
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
