| उत्पाद का नाम |
N,N-Dimethyl-m-toluidine |
| समानार्थी |
N,N,3-Trimethylbenzenamine; N,N-Dimethyl-m-toluidine,(N,N-Dimethyl-3-methylaniline); NN-Dimethyl-m-toluidine; N,N,3-Trimethylaniline; N,N-Dimethyl-m-toliudine; N,N-Dimethyl-3-methylaniline~N,N,3-Trimethylaniline; N,N-Dimethyl-3-toluidin; 2,3,4-trimethylaniline; 3-methyl-N,N-dipropylaniline |
| आणविक फार्मूला |
C13H21N |
| आण्विक वजन |
191.3125 |
| InChI |
InChI=1/C13H21N/c1-4-9-14(10-5-2)13-8-6-7-12(3)11-13/h6-8,11H,4-5,9-10H2,1-3H3 |
| कैस रजिस्टी संख्या |
121-72-2 |
| EINECS |
204-495-6 |
| आणविक संरचना |
|
| घनत्व |
0.912g/cm3 |
| गलनांक |
-15℃ |
| उबलने का समय |
280.2°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.521 |
| फ्लैश प्वाइंट |
113.9°C |
| खतरा प्रतीक |
 T:Toxic;
|
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R52/53:Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| सुरक्षा विवरण |
S28A:After contact with skin, wash immediately with plenty of water.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
