उत्पाद का नाम |
2-quinolinecarbonitrile |
समानार्थी |
Quinoline-2-carbonitrile; 2-Cyanoquinoline |
आणविक फार्मूला |
C10H6N2 |
आण्विक वजन |
154.168 |
InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
कैस रजिस्टी संख्या |
1436-43-7 |
EINECS |
215-865-1 |
आणविक संरचना |
|
घनत्व |
1.21g/cm3 |
गलनांक |
93-95℃ |
उबलने का समय |
323.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.654 |
फ्लैश प्वाइंट |
115.5°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|