| उत्पाद का नाम |
2-Amino-3-cyanopyridine |
| समानार्थी |
2-Aminonicotinonitrile; 3-Cyano-2-pyridinamine; 2-aminopyridine-3-carbonitrile; 2-amino-3-cyanopyridinium |
| आणविक फार्मूला |
C6H6N3 |
| आण्विक वजन |
120.1314 |
| InChI |
InChI=1/C6H5N3/c7-4-5-2-1-3-9-6(5)8/h1-3H,(H2,8,9)/p+1 |
| कैस रजिस्टी संख्या |
24517-64-4 |
| आणविक संरचना |
|
| उबलने का समय |
297.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
133.8°C |
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
