उत्पाद का नाम |
alpha-(N,N-Dimethylamino)ethylferrocene |
समानार्थी |
(+/-)-N,N-Dimethyl-1-ferrocenylethylamine; 1-cyclopenta-2,4-dienyl-[2-(1-dimethylaminoethyl)-1-cyclopenta-2,4-dienyl]iron; N,N-Dimethyl-1-ferrocenylethylamine; [1-(Dimethylamino)ethyl]ferrocene |
आणविक फार्मूला |
C14H17FeN |
आण्विक वजन |
255.1365 |
InChI |
InChI=1/C9H13N.C5H4.Fe/c1-8(10(2)3)9-6-4-5-7-9;1-2-4-5-3-1;/h4-6,8H,1-3H3;1-4H;/q2*-1;+2/rC14H17FeN/c1-11(16(2)3)13-9-6-10-14(13)15-12-7-4-5-8-12/h4-11H,1-3H3 |
कैस रजिस्टी संख्या |
31904-34-4 |
आणविक संरचना |
|
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|