उत्पाद का नाम |
4-heptylaniline |
समानार्थी |
Heptylaniline; 4-n-Heptyaniline |
आणविक फार्मूला |
C13H21N |
आण्विक वजन |
191.3125 |
InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
कैस रजिस्टी संख्या |
37529-27-4 |
आणविक संरचना |
|
घनत्व |
0.923g/cm3 |
उबलने का समय |
282.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.522 |
फ्लैश प्वाइंट |
128.9°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|