उत्पाद का नाम |
N-(2,6-Diethylphenyl)maleimide |
समानार्थी |
1-(2,6-Diethylphenyl)-2,5-dihydro-1H-pyrrole-2,5-dione; 1-(2,6-diethylphenyl)-1H-pyrrole-2,5-dione |
आणविक फार्मूला |
C14H15NO2 |
आण्विक वजन |
229.2744 |
InChI |
InChI=1/C14H15NO2/c1-3-10-6-5-7-11(4-2)14(10)15-12(16)8-9-13(15)17/h5-9H,3-4H2,1-2H3 |
कैस रजिस्टी संख्या |
38167-72-5 |
आणविक संरचना |
|
घनत्व |
1.17g/cm3 |
उबलने का समय |
354.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.582 |
फ्लैश प्वाइंट |
151.2°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|