उत्पाद का नाम |
1-Bromo-4-chloro-2-nitrobenzene |
समानार्थी |
2-Bromo-5-chloronitrobenzene |
आणविक फार्मूला |
C6H3BrClNO2 |
आण्विक वजन |
236.4505 |
InChI |
InChI=1/C6H3BrClNO2/c7-5-2-1-4(8)3-6(5)9(10)11/h1-3H |
कैस रजिस्टी संख्या |
41513-04-6 |
EINECS |
255-421-4 |
आणविक संरचना |
|
घनत्व |
1.827g/cm3 |
गलनांक |
67-70℃ |
उबलने का समय |
242.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.618 |
फ्लैश प्वाइंट |
100.5°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|