| उत्पाद का नाम |
5-ETHYL-2-PYRIDYLETHANOL |
| समानार्थी |
5-Ethyl-2-(2-hydroxyethyl)pyridine; 2-(5-ethyl-2-pyridinyl)-1-ethanol; 2-(5-Ethyl-2-pyridyl)ethanol; 2-(5-ethyl pyridin-2-yl)ethanol; 2-(5-Ethyl-2-pyridinyl)ethanol; 5-Ethyl-2-pyridineethanol |
| आणविक फार्मूला |
C9H13NO |
| आण्विक वजन |
151.21 |
| InChI |
InChI=1/C9H13NO/c1-2-8-3-4-9(5-6-11)10-7-8/h3-4,7,11H,2,5-6H2,1H3 |
| कैस रजिस्टी संख्या |
5223-06-3 |
| EINECS |
226-024-3 |
| आणविक संरचना |
|
| उबलने का समय |
127℃ (5 mmHg) |
| खतरे के कोड |
R21:Harmful in contact with skin.;
R36:Irritating to eyes.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
