| उत्पाद का नाम |
2,6-Dinitrochlorobenzene |
| समानार्थी |
1-Chloro-2,6-dinitrobenzene; 2,6-Dinitrochlorobenzene; 2-chloro-1,3-dinitro-benzene; 2-Chloro-1,3-dinitrobenzene |
| आणविक फार्मूला |
C6H3ClN2O4 |
| आण्विक वजन |
202.552 |
| InChI |
InChI=1/C6H3ClN2O4/c7-6-4(8(10)11)2-1-3-5(6)9(12)13/h1-3H |
| कैस रजिस्टी संख्या |
606-21-3 |
| EINECS |
210-107-6 |
| आणविक संरचना |
|
| घनत्व |
1.619g/cm3 |
| गलनांक |
86-88℃ |
| उबलने का समय |
311.9°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.625 |
| फ्लैश प्वाइंट |
142.4°C |
| खतरे के कोड |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
R50/53:Very toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| सुरक्षा विवरण |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S60:This material and its container must be disposed of as hazardous waste.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
