उत्पाद का नाम |
6-Chloro-2,4-dimethixypyrimidine |
समानार्थी |
6-Chloro-2,4-dimethoxypyrimidine; 4-chloro-2,6-dimethoxypyrimidine |
आणविक फार्मूला |
C6H7ClN2O2 |
आण्विक वजन |
174.585 |
InChI |
InChI=1/C6H7ClN2O2/c1-10-5-3-4(7)8-6(9-5)11-2/h3H,1-2H3 |
कैस रजिस्टी संख्या |
6320-15-6 |
EINECS |
228-669-6 |
आणविक संरचना |
|
घनत्व |
1.285g/cm3 |
गलनांक |
74-76℃ |
उबलने का समय |
280.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.51 |
फ्लैश प्वाइंट |
123.5°C |
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|