| उत्पाद का नाम |
2,3,5,6-tetrafluorothiophenol |
| समानार्थी |
2,3,5,6-Tetrafluorobenzenethiol; 2,3,5,6-tetrafluorobenzenethiolate |
| आणविक फार्मूला |
C6HF4S |
| आण्विक वजन |
181.1313 |
| InChI |
InChI=1/C6H2F4S/c7-2-1-3(8)5(10)6(11)4(2)9/h1,11H/p-1 |
| कैस रजिस्टी संख्या |
769-40-4 |
| EINECS |
212-210-1 |
| आणविक संरचना |
|
| उबलने का समय |
152.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
48.3°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
