उत्पाद का नाम |
5-Bromo-7-nitroindoline |
समानार्थी |
5-Bromo-7-Nitro-2,3-dihydro-1H-indole |
आणविक फार्मूला |
C8H7BrN2O2 |
आण्विक वजन |
243.0574 |
InChI |
InChI=1/C8H7BrN2O2/c9-6-3-5-1-2-10-8(5)7(4-6)11(12)13/h3-4,10H,1-2H2 |
कैस रजिस्टी संख्या |
80166-90-1 |
EINECS |
279-411-4 |
आणविक संरचना |
|
घनत्व |
1.704g/cm3 |
उबलने का समय |
344.2°C at 760 mmHg |
अपवर्तक सूचकांक |
1.64 |
फ्लैश प्वाइंट |
162°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|