نام محصول |
4,5-diamino-6-hydroxy-2-mercapto-pyrimidine |
مترادف |
4,5-Diamino-6-hydroxy-2-mercaptopyrimidine; 4-5-diamino-6-hydroxy-2-*mercaptopyrimidine free; 4,5-diamino-2-mercaptopyrimidine-6-ol; 5,6-Diamino-2-thiouracil; 5,6-diamino-4-hydroxy-2-mercaptopyrimidine; 5,6-diamino-2-mercaptopyrimidin-4-ol; 5,6-diamino-2-thioxo-2,3-dihydropyrimidin-4(1H)-one; 2-Mercapto-4-hydroxy-5,6-diamino-pyrimidine; 5,6-Diamino-2-mercapto-pyrimidin-4-ol |
میدان مغناطیسی |
C4H6N4OS |
وزن مولکولی |
158.1816 |
InChI |
InChI=1/C4H6N4OS/c5-1-2(6)7-4(10)8-3(1)9/h5H2,(H4,6,7,8,9,10) |
شماره سیایاس |
1004-76-8 |
تعداد کمیسیون اروپایی |
213-727-5 |
ساختار مولکولی |
|
تراکم |
1.66g/cm3 |
نقطه ذوب |
>300℃ |
نقطه غلیان |
473°C at 760 mmHg |
ضریب شکست |
1.776 |
نقطه اشتعال |
239.9°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|