نام محصول |
6-ethoxy-2-mercaptobenzothiazole |
مترادف |
6-Ethoxybenzothiazolethiol; 6-ethoxy-1,3-benzothiazole-2(3H)-thione; 6-Ethoxy-Benzothiazole-2-Thiol |
میدان مغناطیسی |
C9H9NOS2 |
وزن مولکولی |
211.3039 |
InChI |
InChI=1/C9H9NOS2/c1-2-11-6-3-4-7-8(5-6)13-9(12)10-7/h3-5H,2H2,1H3,(H,10,12) |
شماره سیایاس |
120-53-6 |
تعداد کمیسیون اروپایی |
204-405-5 |
ساختار مولکولی |
|
تراکم |
1.37g/cm3 |
نقطه ذوب |
198-200℃ |
نقطه غلیان |
358.5°C at 760 mmHg |
ضریب شکست |
1.698 |
نقطه اشتعال |
170.6°C |
کدهای خطر |
R36/37:Irritating to eyes and respiratory system.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|