نام محصول |
triolein |
مترادف |
triolein (C18:1,-cis-9) sigma grade; triolein (C18:1,-cis-9) practical grade; triolein (C18:1,(cis)-9) approx. 95%; Glyceryl trioleate; Glycerine trioleate; 1,2,3-Tri(cis-9-octadecenoyl)glycerol; Glycerol trioleate; Trioleoylglycerol; propane-1,2,3-triyl (9Z,9'Z,9''Z)tris-octadec-9-enoate |
میدان مغناطیسی |
C57H104O6 |
وزن مولکولی |
885.4321 |
InChI |
InChI=1/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
شماره سیایاس |
122-32-7 |
تعداد کمیسیون اروپایی |
204-534-7 |
ساختار مولکولی |
|
تراکم |
0.921g/cm3 |
نقطه غلیان |
818.7°C at 760 mmHg |
ضریب شکست |
1.477 |
نقطه اشتعال |
302.6°C |
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|