نام محصول |
2,3,6-trifluoroacetophenone |
مترادف |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
میدان مغناطیسی |
C8H5F3O |
وزن مولکولی |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
شماره سیایاس |
208173-22-2 |
ساختار مولکولی |
|
تراکم |
1.303g/cm3 |
نقطه غلیان |
187.2°C at 760 mmHg |
ضریب شکست |
1.455 |
نقطه اشتعال |
65°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|