| نام محصول |
1-Benzylpiperidine |
| مترادف |
N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
| میدان مغناطیسی |
C12H18ClN |
| وزن مولکولی |
211.731 |
| InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
| شماره سیایاس |
2905-56-8 |
| تعداد کمیسیون اروپایی |
220-809-4 |
| ساختار مولکولی |
|
| نقطه غلیان |
246.6°C at 760 mmHg |
| نقطه اشتعال |
94°C |
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
