نام محصول |
5-Vinyl-2-norbornene |
مترادف |
5-Vinyl-2-norbornene,mixture of endo and exo; Vinylnorbornene; 2-ethenylbicyclo[2.2.1]hept-1-ene; 5-ethenylbicyclo[2.2.1]hept-1-ene |
وزن مولکولی |
C9H8 |
InChI |
InChI=1/C9H12/c1-2-8-5-7-3-4-9(8)6-7/h2-3,8-9H,1,4-6H2 |
شماره سیایاس |
3048-64-4 |
تعداد کمیسیون اروپایی |
221-259-8 |
ساختار مولکولی |
|
تراکم |
1.612 |
نقطه ذوب |
-80℃ |
نقطه غلیان |
137.909°C |
ضریب شکست |
144.1732 |
نقطه اشتعال |
1.189g/cm3 |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S16:Keep away from sources of ignition - No smoking.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|