نام محصول |
phenyl(4-pyridyl)methanol |
مترادف |
alpha-Phenylpyridine-4-methanol; phenyl(pyridin-4-yl)methanol |
میدان مغناطیسی |
C12H11NO |
وزن مولکولی |
185.2218 |
InChI |
InChI=1/C12H11NO/c14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h1-9,12,14H |
شماره سیایاس |
33974-27-5 |
تعداد کمیسیون اروپایی |
251-770-1 |
ساختار مولکولی |
|
تراکم |
1.155g/cm3 |
نقطه ذوب |
120℃ |
نقطه غلیان |
353.5°C at 760 mmHg |
ضریب شکست |
1.604 |
نقطه اشتعال |
167.6°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|