نام محصول |
4-heptylaniline |
مترادف |
Heptylaniline; 4-n-Heptyaniline |
میدان مغناطیسی |
C13H21N |
وزن مولکولی |
191.3125 |
InChI |
InChI=1/C13H21N/c1-2-3-4-5-6-7-12-8-10-13(14)11-9-12/h8-11H,2-7,14H2,1H3 |
شماره سیایاس |
37529-27-4 |
ساختار مولکولی |
|
تراکم |
0.923g/cm3 |
نقطه غلیان |
282.9°C at 760 mmHg |
ضریب شکست |
1.522 |
نقطه اشتعال |
128.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|