| نام محصول |
3,5-Dimethylphenylacetonitrile |
| مترادف |
3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
| میدان مغناطیسی |
C10H11N |
| وزن مولکولی |
145.201 |
| InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
| شماره سیایاس |
39101-54-7 |
| تعداد کمیسیون اروپایی |
254-292-1 |
| ساختار مولکولی |
|
| تراکم |
0.979g/cm3 |
| نقطه غلیان |
254.5°C at 760 mmHg |
| ضریب شکست |
1.524 |
| نقطه اشتعال |
117.5°C |
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
