نام محصول |
3,5-Dimethylphenylacetonitrile |
مترادف |
3,5-Dimethylbenzyl cyanide; 2-(3,5-Dimethylphenyl)acetonitrile |
میدان مغناطیسی |
C10H11N |
وزن مولکولی |
145.201 |
InChI |
InChI=1/C10H11N/c1-8-5-9(2)7-10(6-8)3-4-11/h5-7H,3H2,1-2H3 |
شماره سیایاس |
39101-54-7 |
تعداد کمیسیون اروپایی |
254-292-1 |
ساختار مولکولی |
|
تراکم |
0.979g/cm3 |
نقطه غلیان |
254.5°C at 760 mmHg |
ضریب شکست |
1.524 |
نقطه اشتعال |
117.5°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|