نام محصول |
Methylphenylpiperazine |
مترادف |
1-(4-Methylphenyl)piperazine; N-(p-Tolyl)piperazine; 1-p-tolylpiperazine |
میدان مغناطیسی |
C11H16N2 |
وزن مولکولی |
176.2581 |
InChI |
InChI=1/C11H16N2/c1-10-2-4-11(5-3-10)13-8-6-12-7-9-13/h2-5,12H,6-9H2,1H3 |
شماره سیایاس |
39593-08-3 |
تعداد کمیسیون اروپایی |
254-534-6 |
ساختار مولکولی |
|
تراکم |
1.012g/cm3 |
نقطه غلیان |
321.2°C at 760 mmHg |
ضریب شکست |
1.54 |
نقطه اشتعال |
153.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|