| نام محصول |
ethylchlorofluoroacetate |
| مترادف |
Ethyl chlorofluoroacetate; Chlorofluoroacetic acid ethyl ester; ethyl (2S)-chloro(fluoro)ethanoate; ethyl (2R)-chloro(fluoro)ethanoate |
| میدان مغناطیسی |
C4H6ClFO2 |
| وزن مولکولی |
140.5406 |
| InChI |
InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
| شماره سیایاس |
401-56-9 |
| تعداد کمیسیون اروپایی |
206-930-5 |
| ساختار مولکولی |
|
| تراکم |
1.219g/cm3 |
| نقطه غلیان |
129°C at 760 mmHg |
| ضریب شکست |
1.39 |
| نقطه اشتعال |
44.3°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
