نام محصول |
5-Chloro-2-nitrobenzamide |
میدان مغناطیسی |
C7H5ClN2O3 |
وزن مولکولی |
200.5792 |
InChI |
InChI=1/C7H5ClN2O3/c8-4-1-2-6(10(12)13)5(3-4)7(9)11/h1-3H,(H2,9,11) |
شماره سیایاس |
40763-96-0 |
ساختار مولکولی |
|
تراکم |
1.52g/cm3 |
نقطه ذوب |
157-160℃ |
نقطه غلیان |
301.7°C at 760 mmHg |
ضریب شکست |
1.624 |
نقطه اشتعال |
136.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|