نام محصول |
4-Ethylphenylacetonitrile |
مترادف |
4-Ethylbenzyl cyanide |
میدان مغناطیسی |
C10H11N |
وزن مولکولی |
145.201 |
InChI |
InChI=1/C10H11N/c1-2-9-3-5-10(6-4-9)7-8-11/h3-6H,2,7H2,1H3 |
شماره سیایاس |
51632-28-1 |
ساختار مولکولی |
|
تراکم |
0.978g/cm3 |
نقطه غلیان |
252.8°C at 760 mmHg |
ضریب شکست |
1.521 |
نقطه اشتعال |
116.1°C |
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|