نام محصول |
2,3-Dimethoxybenzonitrile |
مترادف |
Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
میدان مغناطیسی |
C9H9NO2 |
وزن مولکولی |
163.17 |
InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
شماره سیایاس |
5653-62-3 |
تعداد کمیسیون اروپایی |
227-097-4 |
ساختار مولکولی |
|
نقطه ذوب |
41-46℃ |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|