نام محصول |
NN-Dipropylformamide |
مترادف |
N,N-Di-n-propylformamide; N,N-dipropylformamide |
میدان مغناطیسی |
C7H15NO |
وزن مولکولی |
129.2001 |
InChI |
InChI=1/C7H15NO/c1-3-5-8(7-9)6-4-2/h7H,3-6H2,1-2H3 |
شماره سیایاس |
6282-00-4 |
ساختار مولکولی |
|
تراکم |
0.869g/cm3 |
نقطه غلیان |
221.3°C at 760 mmHg |
ضریب شکست |
1.429 |
نقطه اشتعال |
83.7°C |
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|