| Nome del prodotto |
2-quinolinecarbonitrile |
| Sinonimi |
Quinoline-2-carbonitrile; 2-Cyanoquinoline |
| Formula molecolare |
C10H6N2 |
| Peso Molecolare |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-9-6-5-8-3-1-2-4-10(8)12-9/h1-6H |
| Numero CAS |
1436-43-7 |
| EINECS |
215-865-1 |
| Struttura molecolare |
|
| Densità |
1.21g/cm3 |
| Punto di fusione |
93-95℃ |
| Punto di ebollizione |
323.7°C at 760 mmHg |
| Indice di rifrazione |
1.654 |
| Punto d'infiammabilità |
115.5°C |
| Codici di Rischio |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
