Nome del prodotto |
1,2-Dianilinoethane |
Sinonimi |
N,N-Diphenylethylenediamine; Wanzlicks; 1,2-Dianilinoethane, Pract.; N,N-ethylenedianiline; NN-Diphenylethylenediamine; 1,2-Diphenyl Ethanediamine; N,N'-diphenylethane-1,2-diamine; N,N'-diphenylethane-1,2-diaminium |
Formula molecolare |
C14H16N2 |
Peso Molecolare |
212.2902 |
InChI |
InChI=1/C14H16N2/c15-11-12-16(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12,15H2 |
Numero CAS |
150-61-8 |
EINECS |
205-765-6 |
Struttura molecolare |
|
Densità |
1.093g/cm3 |
Punto di fusione |
64-67℃ |
Punto di ebollizione |
351.529°C at 760 mmHg |
Indice di rifrazione |
1.623 |
Punto d'infiammabilità |
148.617°C |
Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|