Nome del prodotto |
p-butylphenol |
Sinonimi |
4-n-Butylphenol; 4-butylphenol |
Formula molecolare |
C10H14O |
Peso Molecolare |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
Numero CAS |
1638-22-8 |
EINECS |
216-672-5 |
Struttura molecolare |
|
Densità |
0.977g/cm3 |
Punto di ebollizione |
246.2°C at 760 mmHg |
Indice di rifrazione |
1.522 |
Punto d'infiammabilità |
121.5°C |
Codici di Rischio |
R34:Causes burns.;
|
Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|