| Nome del prodotto |
2,3-difluoroacetophenone |
| Sinonimi |
2',3'-difluoroacetophenone; 1-(2,3-difluorophenyl)ethanone |
| Formula molecolare |
C8H6F2O |
| Peso Molecolare |
156.1294 |
| InChI |
InChI=1/C8H6F2O/c1-5(11)6-3-2-4-7(9)8(6)10/h2-4H,1H3 |
| Numero CAS |
18355-80-1 |
| Struttura molecolare |
|
| Densità |
1.206g/cm3 |
| Punto di ebollizione |
193.4°C at 760 mmHg |
| Indice di rifrazione |
1.472 |
| Punto d'infiammabilità |
71.5°C |
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
